Nastia1 Nastia1
  • 02-10-2020
  • Mathematics
contestada

Solve the equation for h.
S = l w + w h + h l

Respuesta :

prstj007
prstj007 prstj007
  • 03-10-2020

Answer:

Check this out..

Step-by-step explanation:

I think I just answered your question

Ver imagen prstj007
Answer Link

Otras preguntas

Does the sentence state a fact or an opinion? Japan is a chain of islands that was settled thirty thousand years ago by people from Siberia and Korea.
Explain why is there no chemical equation to describe what happens when water evaporates?
Can someone pls help me with the essay pls I would really appreciate it
How does boxer rebellion relates to open door?
Curtis played through the next level of a video game. At the beginning of the level, he had 71,486 points. The first time through the level, he lost
What doe the & operator do in python programming software
2/3 times what equals 1​
Aubree had 30 apples.kennyell gave her 50 MORE apples. How many apples does Aubree have left?​
cosec(6b+pi/8)=sec(2b-pi/8)​
Shawn and his bike have a total mass of 46.6 kg. Shawn rides his bike 2.1 km in 13.9 min at a constant velocity. The acceleration of gravity is 9.8 m/s?. What i